C18H15NO3S — CID 158057296
9-methylsulfonyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one (PubChem CID 158057296) has the molecular formula C18H15NO3S and a molecular weight of 325.39 g/mol. Its IUPAC name is 9-methylsulfonyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one.
| Compound Name | 9-methylsulfonyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 158057296 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 9-methylsulfonyl-7,12-dihydro-5H-indeno[1,2-d][1]benzazepin-6-one |
| SMILES | CS(=O)(=O)c1ccc2c(c1)C1=C(C2)c2ccccc2NC(=O)C1 |
| InChI | InChI=1S/C18H15NO3S/c1-23(21,22)12-7-6-11-8-15-13-4-2-3-5-17(13)19-18(20)10-16(15)14(11)9-12/h2-7,9H,8,10H2,1H3,(H,19,20) |
| InChIKey | NBUKKOLFEGKNHH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|