C18H16N2O4S — CID 157130294
2-methoxy-6-oxo-7,12-dihydro-5H-indeno[1,2-d][1]benzazepine-9-sulfonamide (PubChem CID 157130294) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-methoxy-6-oxo-7,12-dihydro-5H-indeno[1,2-d][1]benzazepine-9-sulfonamide.
| Compound Name | 2-methoxy-6-oxo-7,12-dihydro-5H-indeno[1,2-d][1]benzazepine-9-sulfonamide |
|---|---|
| PubChem CID | 157130294 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-methoxy-6-oxo-7,12-dihydro-5H-indeno[1,2-d][1]benzazepine-9-sulfonamide |
| SMILES | COc1ccc2c(c1)C1=C(CC(=O)N2)c2cc(S(N)(=O)=O)ccc2C1 |
| InChI | InChI=1S/C18H16N2O4S/c1-24-11-3-5-17-16(7-11)14-6-10-2-4-12(25(19,22)23)8-13(10)15(14)9-18(21)20-17/h2-5,7-8H,6,9H2,1H3,(H,20,21)(H2,19,22,23) |
| InChIKey | PQAHWLUQJTZLQO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|