C11H12Cl3NO4 — CID 158837669
5-methoxy-1,3-dihydroindol-2-one;2,2,2-trichloroethane-1,1-diol (PubChem CID 158837669) has the molecular formula C11H12Cl3NO4 and a molecular weight of 328.58 g/mol. Its IUPAC name is 5-methoxy-1,3-dihydroindol-2-one;2,2,2-trichloroethane-1,1-diol.
| Compound Name | 5-methoxy-1,3-dihydroindol-2-one;2,2,2-trichloroethane-1,1-diol |
|---|---|
| PubChem CID | 158837669 |
| Molecular Formula | C11H12Cl3NO4 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 5-methoxy-1,3-dihydroindol-2-one;2,2,2-trichloroethane-1,1-diol |
| SMILES | COc1ccc2c(c1)CC(=O)N2.OC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H9NO2.C2H3Cl3O2/c1-12-7-2-3-8-6(4-7)5-9(11)10-8;3-2(4,5)1(6)7/h2-4H,5H2,1H3,(H,10,11);1,6-7H |
| InChIKey | IXVMMOWLTOEIJM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|