C17H11NO8S2 — CID 159306442
(2Z)-3-oxo-2-(3-oxo-5-sulfo-1H-inden-2-ylidene)-1H-indole-7-sulfonic acid (PubChem CID 159306442) has the molecular formula C17H11NO8S2 and a molecular weight of 421.41 g/mol. Its IUPAC name is (2Z)-3-oxo-2-(3-oxo-5-sulfo-1H-inden-2-ylidene)-1H-indole-7-sulfonic acid.
| Compound Name | (2Z)-3-oxo-2-(3-oxo-5-sulfo-1H-inden-2-ylidene)-1H-indole-7-sulfonic acid |
|---|---|
| PubChem CID | 159306442 |
| Molecular Formula | C17H11NO8S2 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | (2Z)-3-oxo-2-(3-oxo-5-sulfo-1H-inden-2-ylidene)-1H-indole-7-sulfonic acid |
| SMILES | O=C1/C(=C2\Nc3c(cccc3S(=O)(=O)O)C2=O)Cc2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C17H11NO8S2/c19-16-11-7-9(27(21,22)23)5-4-8(11)6-12(16)15-17(20)10-2-1-3-13(14(10)18-15)28(24,25)26/h1-5,7,18H,6H2,(H,21,22,23)(H,24,25,26)/b15-12- |
| InChIKey | SBBWGBPSUHFBOV-QINSGFPZSA-N |
| XLogP | 1.48 |
| TPSA | 154.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|