C18H29BN2O4S — CID 165180642
(3S)-1-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidin-3-amine (PubChem CID 165180642) has the molecular formula C18H29BN2O4S and a molecular weight of 380.32 g/mol. Its IUPAC name is (3S)-1-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidin-3-amine.
| Compound Name | (3S)-1-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 165180642 |
| Molecular Formula | C18H29BN2O4S |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (3S)-1-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperidin-3-amine |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(S(=O)(=O)N2CCC[C@H](N)C2)c1 |
| InChI | InChI=1S/C18H29BN2O4S/c1-13-9-14(19-24-17(2,3)18(4,5)25-19)11-16(10-13)26(22,23)21-8-6-7-15(20)12-21/h9-11,15H,6-8,12,20H2,1-5H3/t15-/m0/s1 |
| InChIKey | JYDJYRDCBIFDSE-HNNXBMFYSA-N |
| XLogP | 1.41 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|