C17H28BNO5S — CID 131745073
N-tert-butyl-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (PubChem CID 131745073) has the molecular formula C17H28BNO5S and a molecular weight of 369.29 g/mol. Its IUPAC name is N-tert-butyl-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide.
| Compound Name | N-tert-butyl-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 131745073 |
| Molecular Formula | C17H28BNO5S |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-tert-butyl-2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)ccc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H28BNO5S/c1-15(2,3)19-25(20,21)14-10-9-12(11-13(14)22-8)18-23-16(4,5)17(6,7)24-18/h9-11,19H,1-8H3 |
| InChIKey | JXSWGRJZGORTSW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|