C22H34BF2NO5S — CID 155639885
N-tert-butyl-4-(4,4-difluorocyclohexyl)oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (PubChem CID 155639885) has the molecular formula C22H34BF2NO5S and a molecular weight of 473.39 g/mol. Its IUPAC name is N-tert-butyl-4-(4,4-difluorocyclohexyl)oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide.
| Compound Name | N-tert-butyl-4-(4,4-difluorocyclohexyl)oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 155639885 |
| Molecular Formula | C22H34BF2NO5S |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N-tert-butyl-4-(4,4-difluorocyclohexyl)oxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(OC2CCC(F)(F)CC2)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C22H34BF2NO5S/c1-19(2,3)26-32(27,28)16-8-9-18(29-15-10-12-22(24,25)13-11-15)17(14-16)23-30-20(4,5)21(6,7)31-23/h8-9,14-15,26H,10-13H2,1-7H3 |
| InChIKey | GMGJTIKTQSYNEN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|