C16H11F3N4O2 — CID 75497339
N-[3-(1,2,4-triazol-4-yl)phenyl]-2-(trifluoromethoxy)benzamide (PubChem CID 75497339) has the molecular formula C16H11F3N4O2 and a molecular weight of 348.28 g/mol. Its IUPAC name is N-[3-(1,2,4-triazol-4-yl)phenyl]-2-(trifluoromethoxy)benzamide.
| Compound Name | N-[3-(1,2,4-triazol-4-yl)phenyl]-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 75497339 |
| Molecular Formula | C16H11F3N4O2 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N-[3-(1,2,4-triazol-4-yl)phenyl]-2-(trifluoromethoxy)benzamide |
| SMILES | O=C(Nc1cccc(-n2cnnc2)c1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H11F3N4O2/c17-16(18,19)25-14-7-2-1-6-13(14)15(24)22-11-4-3-5-12(8-11)23-9-20-21-10-23/h1-10H,(H,22,24) |
| InChIKey | RZLDNWPSDJRUMZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |