C10H5F6NO4 — CID 141176315
[[2-(trifluoromethoxy)benzoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 141176315) has the molecular formula C10H5F6NO4 and a molecular weight of 317.14 g/mol. Its IUPAC name is [[2-(trifluoromethoxy)benzoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[2-(trifluoromethoxy)benzoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 141176315 |
| Molecular Formula | C10H5F6NO4 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | [[2-(trifluoromethoxy)benzoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | O=C(NOC(=O)C(F)(F)F)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C10H5F6NO4/c11-9(12,13)8(19)21-17-7(18)5-3-1-2-4-6(5)20-10(14,15)16/h1-4H,(H,17,18) |
| InChIKey | PAHKIRJCCUBDPY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|