C15H13BF3NO4 — CID 140784412
[4-[[[2-(trifluoromethoxy)benzoyl]amino]methyl]phenyl]boronic acid (PubChem CID 140784412) has the molecular formula C15H13BF3NO4 and a molecular weight of 339.08 g/mol. Its IUPAC name is [4-[[[2-(trifluoromethoxy)benzoyl]amino]methyl]phenyl]boronic acid.
| Compound Name | [4-[[[2-(trifluoromethoxy)benzoyl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 140784412 |
| Molecular Formula | C15H13BF3NO4 |
| Molecular Weight | 339.08 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | [4-[[[2-(trifluoromethoxy)benzoyl]amino]methyl]phenyl]boronic acid |
| SMILES | O=C(NCc1ccc(B(O)O)cc1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H13BF3NO4/c17-15(18,19)24-13-4-2-1-3-12(13)14(21)20-9-10-5-7-11(8-6-10)16(22)23/h1-8,22-23H,9H2,(H,20,21) |
| InChIKey | VTZJNHULYFQWML-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.08 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|