C14H15F3N2O2 — CID 69470093
N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-2-(trifluoromethoxy)benzamide (PubChem CID 69470093) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-2-(trifluoromethoxy)benzamide.
| Compound Name | N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 69470093 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-2-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCC1C2CNCC21)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O2/c15-14(16,17)21-12-4-2-1-3-8(12)13(20)19-7-11-9-5-18-6-10(9)11/h1-4,9-11,18H,5-7H2,(H,19,20) |
| InChIKey | WBUTZIOXMBKSOG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |