C14H19NO2 — CID 43676320
N-(1-cyclopropylethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine (PubChem CID 43676320) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine.
| Compound Name | N-(1-cyclopropylethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 43676320 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-(1-cyclopropylethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine |
| SMILES | CC(Nc1ccc2c(c1)OC(C)(C)O2)C1CC1 |
| InChI | InChI=1S/C14H19NO2/c1-9(10-4-5-10)15-11-6-7-12-13(8-11)17-14(2,3)16-12/h6-10,15H,4-5H2,1-3H3 |
| InChIKey | UOCXBAIPCBDASV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|