C13H13NO3 — CID 57245606
8b-methyl-6-nitro-1,2,3,3a-tetrahydrocyclopenta[a]inden-4-one (PubChem CID 57245606) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 8b-methyl-6-nitro-1,2,3,3a-tetrahydrocyclopenta[a]inden-4-one.
| Compound Name | 8b-methyl-6-nitro-1,2,3,3a-tetrahydrocyclopenta[a]inden-4-one |
|---|---|
| PubChem CID | 57245606 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 8b-methyl-6-nitro-1,2,3,3a-tetrahydrocyclopenta[a]inden-4-one |
| SMILES | CC12CCCC1C(=O)c1cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C13H13NO3/c1-13-6-2-3-11(13)12(15)9-7-8(14(16)17)4-5-10(9)13/h4-5,7,11H,2-3,6H2,1H3 |
| InChIKey | FXLZKCZGSXJXJB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|