C12H13NO4 — CID 19696206
3-(5-nitro-2,3-dihydro-1H-inden-1-yl)propanoic acid (PubChem CID 19696206) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 3-(5-nitro-2,3-dihydro-1H-inden-1-yl)propanoic acid.
| Compound Name | 3-(5-nitro-2,3-dihydro-1H-inden-1-yl)propanoic acid |
|---|---|
| PubChem CID | 19696206 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-(5-nitro-2,3-dihydro-1H-inden-1-yl)propanoic acid |
| SMILES | O=C(O)CCC1CCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C12H13NO4/c14-12(15)6-3-8-1-2-9-7-10(13(16)17)4-5-11(8)9/h4-5,7-8H,1-3,6H2,(H,14,15) |
| InChIKey | JVVSHTJGKUKQGY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|