C12H13N3O5 — CID 70091178
2-(5-methyl-7-nitro-3-oxo-2,5-dihydro-1H-2,4-benzodiazepin-4-yl)acetic acid (PubChem CID 70091178) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is 2-(5-methyl-7-nitro-3-oxo-2,5-dihydro-1H-2,4-benzodiazepin-4-yl)acetic acid.
| Compound Name | 2-(5-methyl-7-nitro-3-oxo-2,5-dihydro-1H-2,4-benzodiazepin-4-yl)acetic acid |
|---|---|
| PubChem CID | 70091178 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-(5-methyl-7-nitro-3-oxo-2,5-dihydro-1H-2,4-benzodiazepin-4-yl)acetic acid |
| SMILES | CC1c2cc([N+](=O)[O-])ccc2CNC(=O)N1CC(=O)O |
| InChI | InChI=1S/C12H13N3O5/c1-7-10-4-9(15(19)20)3-2-8(10)5-13-12(18)14(7)6-11(16)17/h2-4,7H,5-6H2,1H3,(H,13,18)(H,16,17) |
| InChIKey | RLGJGHFSRBOVBJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|