C15H17BrN2O2S — CID 67971150
(4aS,9aR)-2'-amino-7-bromospiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-3-ol (PubChem CID 67971150) has the molecular formula C15H17BrN2O2S and a molecular weight of 369.28 g/mol. Its IUPAC name is (4aS,9aR)-2'-amino-7-bromospiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-3-ol.
| Compound Name | (4aS,9aR)-2'-amino-7-bromospiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-3-ol |
|---|---|
| PubChem CID | 67971150 |
| Molecular Formula | C15H17BrN2O2S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | (4aS,9aR)-2'-amino-7-bromospiro[1,2,3,4,4a,9a-hexahydroxanthene-9,4'-5H-1,3-thiazole]-3-ol |
| SMILES | NC1=NC2(CS1)c1cc(Br)ccc1O[C@H]1CC(O)CC[C@@H]12 |
| InChI | InChI=1S/C15H17BrN2O2S/c16-8-1-4-12-11(5-8)15(7-21-14(17)18-15)10-3-2-9(19)6-13(10)20-12/h1,4-5,9-10,13,19H,2-3,6-7H2,(H2,17,18)/t9?,10-,13-,15?/m0/s1 |
| InChIKey | GXRLBIMWMXKMAM-JTMGSUHQSA-N |
| XLogP | 2.63 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |