C19H14N4OS — CID 143958022
1'-pyrimidin-5-ylspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine (PubChem CID 143958022) has the molecular formula C19H14N4OS and a molecular weight of 346.42 g/mol. Its IUPAC name is 1'-pyrimidin-5-ylspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine.
| Compound Name | 1'-pyrimidin-5-ylspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 143958022 |
| Molecular Formula | C19H14N4OS |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1'-pyrimidin-5-ylspiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine |
| SMILES | NC1=NC2(CS1)c1ccccc1Oc1cccc(-c3cncnc3)c12 |
| InChI | InChI=1S/C19H14N4OS/c20-18-23-19(10-25-18)14-5-1-2-6-15(14)24-16-7-3-4-13(17(16)19)12-8-21-11-22-9-12/h1-9,11H,10H2,(H2,20,23) |
| InChIKey | AKFWBBWOJXIMAS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |