C20H14FN3O2 — CID 68577336
1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (PubChem CID 68577336) has the molecular formula C20H14FN3O2 and a molecular weight of 347.35 g/mol. Its IUPAC name is 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
| Compound Name | 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 68577336 |
| Molecular Formula | C20H14FN3O2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| SMILES | NC1=NC2(CO1)c1ccccc1Oc1ccc(-c3cccnc3)c(F)c12 |
| InChI | InChI=1S/C20H14FN3O2/c21-18-13(12-4-3-9-23-10-12)7-8-16-17(18)20(11-25-19(22)24-20)14-5-1-2-6-15(14)26-16/h1-10H,11H2,(H2,22,24) |
| InChIKey | ZMBISMPZBYPEFK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |