About 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine
1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (PubChem CID 68577336) has the molecular formula C20H14FN3O2
and a molecular weight of 347.35 g/mol. Its IUPAC name is 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
Molecular Properties
| Compound Name | 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| PubChem CID | 68577336 |
| Molecular Formula | C20H14FN3O2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| SMILES | NC1=NC2(CO1)c1ccccc1Oc1ccc(-c3cccnc3)c(F)c12 |
| InChI | InChI=1S/C20H14FN3O2/c21-18-13(12-4-3-9-23-10-12)7-8-16-17(18)20(11-25-19(22)24-20)14-5-1-2-6-15(14)26-16/h1-10H,11H2,(H2,22,24) |
| InChIKey | ZMBISMPZBYPEFK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine?
The IUPAC name of 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (CID 68577336) is 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
What is the SMILES notation for 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine?
The canonical SMILES for 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine is NC1=NC2(CO1)c1ccccc1Oc1ccc(-c3cccnc3)c(F)c12.
What is the InChIKey of 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine?
The InChIKey is ZMBISMPZBYPEFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14FN3O2/c21-18-13(12-4-3-9-23-10-12)7-8-16-17(18)20(11-25-19(22)24-20)14-5-1-2-6-15(14)26-16/h1-10H,11H2,(H2,22,24).
What are the key properties of 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine?
1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine has a molecular weight of 347.35 g/mol, XLogP of 3.58, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-fluoro-2'-pyridin-3-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine is sourced from PubChem (CID 68577336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).