C18H18N2O3 — CID 68577523
1'-propoxyspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (PubChem CID 68577523) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 1'-propoxyspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
| Compound Name | 1'-propoxyspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 68577523 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1'-propoxyspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| SMILES | CCCOc1cccc2c1C1(COC(N)=N1)c1ccccc1O2 |
| InChI | InChI=1S/C18H18N2O3/c1-2-10-21-14-8-5-9-15-16(14)18(11-22-17(19)20-18)12-6-3-4-7-13(12)23-15/h3-9H,2,10-11H2,1H3,(H2,19,20) |
| InChIKey | DEASCNIWZHWSFY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |