C13H18N2O3 — CID 21471035
3,3-dimethoxy-4-propoxyisoindol-1-amine (PubChem CID 21471035) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3,3-dimethoxy-4-propoxyisoindol-1-amine.
| Compound Name | 3,3-dimethoxy-4-propoxyisoindol-1-amine |
|---|---|
| PubChem CID | 21471035 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 3,3-dimethoxy-4-propoxyisoindol-1-amine |
| SMILES | CCCOc1cccc2c1C(OC)(OC)N=C2N |
| InChI | InChI=1S/C13H18N2O3/c1-4-8-18-10-7-5-6-9-11(10)13(16-2,17-3)15-12(9)14/h5-7H,4,8H2,1-3H3,(H2,14,15) |
| InChIKey | RXNZNEWFPPYYNP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|