C15H22N2O3 — CID 21470796
3,3-diethoxy-7-propoxyisoindol-1-amine (PubChem CID 21470796) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3,3-diethoxy-7-propoxyisoindol-1-amine.
| Compound Name | 3,3-diethoxy-7-propoxyisoindol-1-amine |
|---|---|
| PubChem CID | 21470796 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3,3-diethoxy-7-propoxyisoindol-1-amine |
| SMILES | CCCOc1cccc2c1C(N)=NC2(OCC)OCC |
| InChI | InChI=1S/C15H22N2O3/c1-4-10-18-12-9-7-8-11-13(12)14(16)17-15(11,19-5-2)20-6-3/h7-9H,4-6,10H2,1-3H3,(H2,16,17) |
| InChIKey | RFEMJJUPJSXWNQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|