C13H16N2O3 — CID 21470732
7'-ethoxyspiro[dioxane-3,3'-isoindole]-1'-amine (PubChem CID 21470732) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 7'-ethoxyspiro[dioxane-3,3'-isoindole]-1'-amine.
| Compound Name | 7'-ethoxyspiro[dioxane-3,3'-isoindole]-1'-amine |
|---|---|
| PubChem CID | 21470732 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 7'-ethoxyspiro[dioxane-3,3'-isoindole]-1'-amine |
| SMILES | CCOc1cccc2c1C(N)=NC21CCCOO1 |
| InChI | InChI=1S/C13H16N2O3/c1-2-16-10-6-3-5-9-11(10)12(14)15-13(9)7-4-8-17-18-13/h3,5-6H,2,4,7-8H2,1H3,(H2,14,15) |
| InChIKey | CQJFBIMSDRNAHP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|