C15H18O — CID 123667058
4'-ethoxyspiro[cyclopentane-1,1'-indene] (PubChem CID 123667058) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 4'-ethoxyspiro[cyclopentane-1,1'-indene].
| Compound Name | 4'-ethoxyspiro[cyclopentane-1,1'-indene] |
|---|---|
| PubChem CID | 123667058 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 4'-ethoxyspiro[cyclopentane-1,1'-indene] |
| SMILES | CCOc1cccc2c1C=CC21CCCC1 |
| InChI | InChI=1S/C15H18O/c1-2-16-14-7-5-6-13-12(14)8-11-15(13)9-3-4-10-15/h5-8,11H,2-4,9-10H2,1H3 |
| InChIKey | HXVIOSTVKIUYLO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |