C15H18O2 — CID 118314361
4',7'-dimethoxyspiro[cyclopentane-1,1'-indene] (PubChem CID 118314361) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 4',7'-dimethoxyspiro[cyclopentane-1,1'-indene].
| Compound Name | 4',7'-dimethoxyspiro[cyclopentane-1,1'-indene] |
|---|---|
| PubChem CID | 118314361 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 4',7'-dimethoxyspiro[cyclopentane-1,1'-indene] |
| SMILES | COc1ccc(OC)c2c1C=CC21CCCC1 |
| InChI | InChI=1S/C15H18O2/c1-16-12-5-6-13(17-2)14-11(12)7-10-15(14)8-3-4-9-15/h5-7,10H,3-4,8-9H2,1-2H3 |
| InChIKey | HMZNDHSTAAWWDM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |