About 4-methoxyspiro[indene-1,3'-oxolane]
4-methoxyspiro[indene-1,3'-oxolane] (PubChem CID 118314490) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 4-methoxyspiro[indene-1,3'-oxolane].
Molecular Properties
| Compound Name | 4-methoxyspiro[indene-1,3'-oxolane] |
| PubChem CID | 118314490 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 4-methoxyspiro[indene-1,3'-oxolane] |
| SMILES | COc1cccc2c1C=CC21CCOC1 |
| InChI | InChI=1S/C13H14O2/c1-14-12-4-2-3-11-10(12)5-6-13(11)7-8-15-9-13/h2-6H,7-9H2,1H3 |
| InChIKey | FPWFAZKZKSRRGL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxyspiro[indene-1,3'-oxolane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxyspiro[indene-1,3'-oxolane]?
The IUPAC name of 4-methoxyspiro[indene-1,3'-oxolane] (CID 118314490) is 4-methoxyspiro[indene-1,3'-oxolane].
What is the SMILES notation for 4-methoxyspiro[indene-1,3'-oxolane]?
The canonical SMILES for 4-methoxyspiro[indene-1,3'-oxolane] is COc1cccc2c1C=CC21CCOC1.
What is the InChIKey of 4-methoxyspiro[indene-1,3'-oxolane]?
The InChIKey is FPWFAZKZKSRRGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c1-14-12-4-2-3-11-10(12)5-6-13(11)7-8-15-9-13/h2-6H,7-9H2,1H3.
What are the key properties of 4-methoxyspiro[indene-1,3'-oxolane]?
4-methoxyspiro[indene-1,3'-oxolane] has a molecular weight of 202.25 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxyspiro[indene-1,3'-oxolane] is sourced from PubChem (CID 118314490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).