C14H18O2 — CID 118314453
7-methoxyspiro[1,2-dihydroindene-3,4'-oxane] (PubChem CID 118314453) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 7-methoxyspiro[1,2-dihydroindene-3,4'-oxane].
| Compound Name | 7-methoxyspiro[1,2-dihydroindene-3,4'-oxane] |
|---|---|
| PubChem CID | 118314453 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 7-methoxyspiro[1,2-dihydroindene-3,4'-oxane] |
| SMILES | COc1cccc2c1CCC21CCOCC1 |
| InChI | InChI=1S/C14H18O2/c1-15-13-4-2-3-12-11(13)5-6-14(12)7-9-16-10-8-14/h2-4H,5-10H2,1H3 |
| InChIKey | KTSDFRLHTHPHRU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |