C14H20FNO2 — CID 117386175
[1-(2-fluoro-3,6-dimethoxyphenyl)cyclopentyl]methanamine (PubChem CID 117386175) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is [1-(2-fluoro-3,6-dimethoxyphenyl)cyclopentyl]methanamine.
| Compound Name | [1-(2-fluoro-3,6-dimethoxyphenyl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 117386175 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | [1-(2-fluoro-3,6-dimethoxyphenyl)cyclopentyl]methanamine |
| SMILES | COc1ccc(OC)c(C2(CN)CCCC2)c1F |
| InChI | InChI=1S/C14H20FNO2/c1-17-10-5-6-11(18-2)13(15)12(10)14(9-16)7-3-4-8-14/h5-6H,3-4,7-9,16H2,1-2H3 |
| InChIKey | PHLQFKYALYEXHR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |