C15H22FNO3 — CID 117455550
3-[1-(aminomethyl)cyclohexyl]-2-fluoro-4,5-dimethoxyphenol (PubChem CID 117455550) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is 3-[1-(aminomethyl)cyclohexyl]-2-fluoro-4,5-dimethoxyphenol.
| Compound Name | 3-[1-(aminomethyl)cyclohexyl]-2-fluoro-4,5-dimethoxyphenol |
|---|---|
| PubChem CID | 117455550 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 3-[1-(aminomethyl)cyclohexyl]-2-fluoro-4,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(F)c(C2(CN)CCCCC2)c1OC |
| InChI | InChI=1S/C15H22FNO3/c1-19-11-8-10(18)13(16)12(14(11)20-2)15(9-17)6-4-3-5-7-15/h8,18H,3-7,9,17H2,1-2H3 |
| InChIKey | AHEXRJGAJPHCGX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |