C20H19N3O2 — CID 154356863
(4S)-3'-(3,3-dimethylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-2-amine (PubChem CID 154356863) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is (4S)-3'-(3,3-dimethylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-2-amine.
| Compound Name | (4S)-3'-(3,3-dimethylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-2-amine |
|---|---|
| PubChem CID | 154356863 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (4S)-3'-(3,3-dimethylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-2-amine |
| SMILES | CC(C)(C)C#Cc1cnc2c(c1)[C@]1(COC(N)=N1)c1ccccc1O2 |
| InChI | InChI=1S/C20H19N3O2/c1-19(2,3)9-8-13-10-15-17(22-11-13)25-16-7-5-4-6-14(16)20(15)12-24-18(21)23-20/h4-7,10-11H,12H2,1-3H3,(H2,21,23)/t20-/m0/s1 |
| InChIKey | OBTZMZRJJHVXKE-FQEVSTJZSA-N |
| XLogP | 3.17 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|