C24H20N4O3 — CID 59272380
4-[(4S)-2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-yl]-2-methylbut-3-yn-2-ol (PubChem CID 59272380) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is 4-[(4S)-2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[(4S)-2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 59272380 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-[(4S)-2-amino-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2'-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1ccc2c(c1)[C@@]1(COC(N)=N1)c1cc(-c3cncnc3)ccc1O2 |
| InChI | InChI=1S/C24H20N4O3/c1-23(2,29)8-7-15-3-5-20-18(9-15)24(13-30-22(25)28-24)19-10-16(4-6-21(19)31-20)17-11-26-14-27-12-17/h3-6,9-12,14,29H,13H2,1-2H3,(H2,25,28)/t24-/m0/s1 |
| InChIKey | QGAWXOQEXMZKDG-DEOSSOPVSA-N |
| XLogP | 2.96 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|