C23H20N4O3 — CID 143958059
[(9S)-2-(3-hydroxy-3-methylbut-1-ynyl)-7-pyrimidin-5-yl-9H-xanthen-9-yl]urea (PubChem CID 143958059) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is [(9S)-2-(3-hydroxy-3-methylbut-1-ynyl)-7-pyrimidin-5-yl-9H-xanthen-9-yl]urea.
| Compound Name | [(9S)-2-(3-hydroxy-3-methylbut-1-ynyl)-7-pyrimidin-5-yl-9H-xanthen-9-yl]urea |
|---|---|
| PubChem CID | 143958059 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | [(9S)-2-(3-hydroxy-3-methylbut-1-ynyl)-7-pyrimidin-5-yl-9H-xanthen-9-yl]urea |
| SMILES | CC(C)(O)C#Cc1ccc2c(c1)[C@H](NC(N)=O)c1cc(-c3cncnc3)ccc1O2 |
| InChI | InChI=1S/C23H20N4O3/c1-23(2,29)8-7-14-3-5-19-17(9-14)21(27-22(24)28)18-10-15(4-6-20(18)30-19)16-11-25-13-26-12-16/h3-6,9-13,21,29H,1-2H3,(H3,24,27,28)/t21-/m0/s1 |
| InChIKey | FKBULLFAMYEFBR-NRFANRHFSA-N |
| XLogP | 3.13 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|