C26H26N4O2 — CID 143958079
butane;2'-prop-1-ynyl-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (PubChem CID 143958079) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is butane;2'-prop-1-ynyl-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
| Compound Name | butane;2'-prop-1-ynyl-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 143958079 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | butane;2'-prop-1-ynyl-7'-pyrimidin-5-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| SMILES | CC#Cc1ccc2c(c1)C1(COC(N)=N1)c1cc(-c3cncnc3)ccc1O2.CCCC |
| InChI | InChI=1S/C22H16N4O2.C4H10/c1-2-3-14-4-6-19-17(8-14)22(12-27-21(23)26-22)18-9-15(5-7-20(18)28-19)16-10-24-13-25-11-16;1-3-4-2/h4-11,13H,12H2,1H3,(H2,23,26);3-4H2,1-2H3 |
| InChIKey | SVKFITDUXBYNJY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|