C20H22N2O3 — CID 68576946
1'-(2,2-dimethylpropoxy)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (PubChem CID 68576946) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1'-(2,2-dimethylpropoxy)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
| Compound Name | 1'-(2,2-dimethylpropoxy)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 68576946 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1'-(2,2-dimethylpropoxy)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| SMILES | CC(C)(C)COc1cccc2c1C1(COC(N)=N1)c1ccccc1O2 |
| InChI | InChI=1S/C20H22N2O3/c1-19(2,3)11-23-15-9-6-10-16-17(15)20(12-24-18(21)22-20)13-7-4-5-8-14(13)25-16/h4-10H,11-12H2,1-3H3,(H2,21,22) |
| InChIKey | UVIKYDZEKITBHV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |