C26H33BN2O5 — CID 58466224
(4R)-2'-(2,2-dimethylpropoxy)-7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (PubChem CID 58466224) has the molecular formula C26H33BN2O5 and a molecular weight of 464.37 g/mol. Its IUPAC name is (4R)-2'-(2,2-dimethylpropoxy)-7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
| Compound Name | (4R)-2'-(2,2-dimethylpropoxy)-7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 58466224 |
| Molecular Formula | C26H33BN2O5 |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | (4R)-2'-(2,2-dimethylpropoxy)-7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| SMILES | CC(C)(C)COc1ccc2c(c1)[C@@]1(COC(N)=N1)c1cc(B3OC(C)(C)C(C)(C)O3)ccc1O2 |
| InChI | InChI=1S/C26H33BN2O5/c1-23(2,3)14-30-17-9-11-21-19(13-17)26(15-31-22(28)29-26)18-12-16(8-10-20(18)32-21)27-33-24(4,5)25(6,7)34-27/h8-13H,14-15H2,1-7H3,(H2,28,29)/t26-/m1/s1 |
| InChIKey | FLWPWBVPLUBXTH-AREMUKBSSA-N |
| XLogP | 4.10 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|