C18H19BN2O3 — CID 89180301
CID 89180301 (PubChem CID 89180301) has the molecular formula C18H19BN2O3 and a molecular weight of 322.17 g/mol.
| Compound Name | CID 89180301 |
|---|---|
| PubChem CID | 89180301 |
| Molecular Formula | C18H19BN2O3 |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(C2(c3ccc(OCCOC)cc3)COC(N)=N2)c1 |
| InChI | InChI=1S/C18H19BN2O3/c1-22-9-10-23-16-7-5-13(6-8-16)18(12-24-17(20)21-18)14-3-2-4-15(19)11-14/h2-8,11H,9-10,12H2,1H3,(H2,20,21) |
| InChIKey | VXGJRGTYJBLROF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|