C22H19ClN2O — CID 67347783
(4S)-4-[3-(3-chlorophenyl)phenyl]-4-(3-methylphenyl)-5H-1,3-oxazol-2-amine (PubChem CID 67347783) has the molecular formula C22H19ClN2O and a molecular weight of 362.86 g/mol. Its IUPAC name is (4S)-4-[3-(3-chlorophenyl)phenyl]-4-(3-methylphenyl)-5H-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-[3-(3-chlorophenyl)phenyl]-4-(3-methylphenyl)-5H-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 67347783 |
| Molecular Formula | C22H19ClN2O |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (4S)-4-[3-(3-chlorophenyl)phenyl]-4-(3-methylphenyl)-5H-1,3-oxazol-2-amine |
| SMILES | Cc1cccc([C@]2(c3cccc(-c4cccc(Cl)c4)c3)COC(N)=N2)c1 |
| InChI | InChI=1S/C22H19ClN2O/c1-15-5-2-8-18(11-15)22(14-26-21(24)25-22)19-9-3-6-16(12-19)17-7-4-10-20(23)13-17/h2-13H,14H2,1H3,(H2,24,25)/t22-/m0/s1 |
| InChIKey | RLNHXGUSYSEYPD-QFIPXVFZSA-N |
| XLogP | 4.90 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |