C18H19BN2O2 — CID 89180418
CID 89180418 (PubChem CID 89180418) has the molecular formula C18H19BN2O2 and a molecular weight of 306.17 g/mol.
| Compound Name | CID 89180418 |
|---|---|
| PubChem CID | 89180418 |
| Molecular Formula | C18H19BN2O2 |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(C2(c3ccc(OC(C)C)cc3)COC(N)=N2)c1 |
| InChI | InChI=1S/C18H19BN2O2/c1-12(2)23-16-8-6-13(7-9-16)18(11-22-17(20)21-18)14-4-3-5-15(19)10-14/h3-10,12H,11H2,1-2H3,(H2,20,21) |
| InChIKey | GASFDCPGVMUEEE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|