C21H15F4N3O2 — CID 67348455
(4S)-4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-[4-(trifluoromethoxy)phenyl]-5H-1,3-oxazol-2-amine (PubChem CID 67348455) has the molecular formula C21H15F4N3O2 and a molecular weight of 417.36 g/mol. Its IUPAC name is (4S)-4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-[4-(trifluoromethoxy)phenyl]-5H-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-[4-(trifluoromethoxy)phenyl]-5H-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 67348455 |
| Molecular Formula | C21H15F4N3O2 |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (4S)-4-[3-(6-fluoro-3-pyridinyl)phenyl]-4-[4-(trifluoromethoxy)phenyl]-5H-1,3-oxazol-2-amine |
| SMILES | NC1=N[C@@](c2ccc(OC(F)(F)F)cc2)(c2cccc(-c3ccc(F)nc3)c2)CO1 |
| InChI | InChI=1S/C21H15F4N3O2/c22-18-9-4-14(11-27-18)13-2-1-3-16(10-13)20(12-29-19(26)28-20)15-5-7-17(8-6-15)30-21(23,24)25/h1-11H,12H2,(H2,26,28)/t20-/m0/s1 |
| InChIKey | RCOIEQDIZRURMF-FQEVSTJZSA-N |
| XLogP | 4.37 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|