C25H24F2N2O5 — CID 87365268
4-[4-(2-fluoroethoxy)phenyl]-4-[3-(2-fluoro-5-methoxyphenyl)phenyl]-5H-1,3-oxazol-2-amine;formic acid (PubChem CID 87365268) has the molecular formula C25H24F2N2O5 and a molecular weight of 470.47 g/mol. Its IUPAC name is 4-[4-(2-fluoroethoxy)phenyl]-4-[3-(2-fluoro-5-methoxyphenyl)phenyl]-5H-1,3-oxazol-2-amine;formic acid.
| Compound Name | 4-[4-(2-fluoroethoxy)phenyl]-4-[3-(2-fluoro-5-methoxyphenyl)phenyl]-5H-1,3-oxazol-2-amine;formic acid |
|---|---|
| PubChem CID | 87365268 |
| Molecular Formula | C25H24F2N2O5 |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 4-[4-(2-fluoroethoxy)phenyl]-4-[3-(2-fluoro-5-methoxyphenyl)phenyl]-5H-1,3-oxazol-2-amine;formic acid |
| SMILES | COc1ccc(F)c(-c2cccc(C3(c4ccc(OCCF)cc4)COC(N)=N3)c2)c1.O=CO |
| InChI | InChI=1S/C24H22F2N2O3.CH2O2/c1-29-20-9-10-22(26)21(14-20)16-3-2-4-18(13-16)24(15-31-23(27)28-24)17-5-7-19(8-6-17)30-12-11-25;2-1-3/h2-10,13-14H,11-12,15H2,1H3,(H2,27,28);1H,(H,2,3) |
| InChIKey | KSHBNYACCFBJFS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|