C23H19FN2O4 — CID 70968331
amino (4S)-4-[4-fluoro-3-(3-methoxyphenyl)phenyl]-4-phenyl-5H-1,3-oxazole-2-carboxylate (PubChem CID 70968331) has the molecular formula C23H19FN2O4 and a molecular weight of 406.41 g/mol. Its IUPAC name is amino (4S)-4-[4-fluoro-3-(3-methoxyphenyl)phenyl]-4-phenyl-5H-1,3-oxazole-2-carboxylate.
| Compound Name | amino (4S)-4-[4-fluoro-3-(3-methoxyphenyl)phenyl]-4-phenyl-5H-1,3-oxazole-2-carboxylate |
|---|---|
| PubChem CID | 70968331 |
| Molecular Formula | C23H19FN2O4 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | amino (4S)-4-[4-fluoro-3-(3-methoxyphenyl)phenyl]-4-phenyl-5H-1,3-oxazole-2-carboxylate |
| SMILES | COc1cccc(-c2cc([C@@]3(c4ccccc4)COC(C(=O)ON)=N3)ccc2F)c1 |
| InChI | InChI=1S/C23H19FN2O4/c1-28-18-9-5-6-15(12-18)19-13-17(10-11-20(19)24)23(16-7-3-2-4-8-16)14-29-21(26-23)22(27)30-25/h2-13H,14,25H2,1H3/t23-/m0/s1 |
| InChIKey | PDLQFUYOBPAXAD-QHCPKHFHSA-N |
| XLogP | 3.59 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|