C23H24N4O4 — CID 67347587
4-(4-ethoxy-3-methylphenyl)-4-(3-pyrimidin-5-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid (PubChem CID 67347587) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 4-(4-ethoxy-3-methylphenyl)-4-(3-pyrimidin-5-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid.
| Compound Name | 4-(4-ethoxy-3-methylphenyl)-4-(3-pyrimidin-5-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid |
|---|---|
| PubChem CID | 67347587 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-(4-ethoxy-3-methylphenyl)-4-(3-pyrimidin-5-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid |
| SMILES | CCOc1ccc(C2(c3cccc(-c4cncnc4)c3)COC(N)=N2)cc1C.O=CO |
| InChI | InChI=1S/C22H22N4O2.CH2O2/c1-3-27-20-8-7-19(9-15(20)2)22(13-28-21(23)26-22)18-6-4-5-16(10-18)17-11-24-14-25-12-17;2-1-3/h4-12,14H,3,13H2,1-2H3,(H2,23,26);1H,(H,2,3) |
| InChIKey | FKZKJEUNIZCTLP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|