C25H25N3O4 — CID 87364987
[[4-(3-methyl-4-propan-2-yloxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-yl]amino] formate (PubChem CID 87364987) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is [[4-(3-methyl-4-propan-2-yloxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-yl]amino] formate.
| Compound Name | [[4-(3-methyl-4-propan-2-yloxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-yl]amino] formate |
|---|---|
| PubChem CID | 87364987 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [[4-(3-methyl-4-propan-2-yloxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-yl]amino] formate |
| SMILES | Cc1cc(C2(c3cccc(-c4cccnc4)c3)COC(NOC=O)=N2)ccc1OC(C)C |
| InChI | InChI=1S/C25H25N3O4/c1-17(2)32-23-10-9-22(12-18(23)3)25(15-30-24(27-25)28-31-16-29)21-8-4-6-19(13-21)20-7-5-11-26-14-20/h4-14,16-17H,15H2,1-3H3,(H,27,28) |
| InChIKey | SVJNIRIKXBPZMB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|