C23H21N3O5 — CID 87365849
[[4-(4-methoxyphenyl)-4-[3-(5-methoxy-3-pyridinyl)phenyl]-5H-1,3-oxazol-2-yl]amino] formate (PubChem CID 87365849) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is [[4-(4-methoxyphenyl)-4-[3-(5-methoxy-3-pyridinyl)phenyl]-5H-1,3-oxazol-2-yl]amino] formate.
| Compound Name | [[4-(4-methoxyphenyl)-4-[3-(5-methoxy-3-pyridinyl)phenyl]-5H-1,3-oxazol-2-yl]amino] formate |
|---|---|
| PubChem CID | 87365849 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [[4-(4-methoxyphenyl)-4-[3-(5-methoxy-3-pyridinyl)phenyl]-5H-1,3-oxazol-2-yl]amino] formate |
| SMILES | COc1ccc(C2(c3cccc(-c4cncc(OC)c4)c3)COC(NOC=O)=N2)cc1 |
| InChI | InChI=1S/C23H21N3O5/c1-28-20-8-6-18(7-9-20)23(14-30-22(25-23)26-31-15-27)19-5-3-4-16(10-19)17-11-21(29-2)13-24-12-17/h3-13,15H,14H2,1-2H3,(H,25,26) |
| InChIKey | YLLPAUNRJWSCND-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|