C22H18F2N4O4 — CID 87364784
[[4-[4-(difluoromethoxy)-2-methylphenyl]-4-(3-pyrimidin-5-ylphenyl)-5H-1,3-oxazol-2-yl]amino] formate (PubChem CID 87364784) has the molecular formula C22H18F2N4O4 and a molecular weight of 440.41 g/mol. Its IUPAC name is [[4-[4-(difluoromethoxy)-2-methylphenyl]-4-(3-pyrimidin-5-ylphenyl)-5H-1,3-oxazol-2-yl]amino] formate.
| Compound Name | [[4-[4-(difluoromethoxy)-2-methylphenyl]-4-(3-pyrimidin-5-ylphenyl)-5H-1,3-oxazol-2-yl]amino] formate |
|---|---|
| PubChem CID | 87364784 |
| Molecular Formula | C22H18F2N4O4 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | [[4-[4-(difluoromethoxy)-2-methylphenyl]-4-(3-pyrimidin-5-ylphenyl)-5H-1,3-oxazol-2-yl]amino] formate |
| SMILES | Cc1cc(OC(F)F)ccc1C1(c2cccc(-c3cncnc3)c2)COC(NOC=O)=N1 |
| InChI | InChI=1S/C22H18F2N4O4/c1-14-7-18(32-20(23)24)5-6-19(14)22(11-30-21(27-22)28-31-13-29)17-4-2-3-15(8-17)16-9-25-12-26-10-16/h2-10,12-13,20H,11H2,1H3,(H,27,28) |
| InChIKey | UJLSKZLDWALGHA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|