C22H20F2N4O4 — CID 67345684
4-[4-(difluoromethoxy)-3-methylphenyl]-4-(3-pyrazin-2-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid (PubChem CID 67345684) has the molecular formula C22H20F2N4O4 and a molecular weight of 442.42 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)-3-methylphenyl]-4-(3-pyrazin-2-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid.
| Compound Name | 4-[4-(difluoromethoxy)-3-methylphenyl]-4-(3-pyrazin-2-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid |
|---|---|
| PubChem CID | 67345684 |
| Molecular Formula | C22H20F2N4O4 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 4-[4-(difluoromethoxy)-3-methylphenyl]-4-(3-pyrazin-2-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid |
| SMILES | Cc1cc(C2(c3cccc(-c4cnccn4)c3)COC(N)=N2)ccc1OC(F)F.O=CO |
| InChI | InChI=1S/C21H18F2N4O2.CH2O2/c1-13-9-16(5-6-18(13)29-19(22)23)21(12-28-20(24)27-21)15-4-2-3-14(10-15)17-11-25-7-8-26-17;2-1-3/h2-11,19H,12H2,1H3,(H2,24,27);1H,(H,2,3) |
| InChIKey | UVTTWUUKFIYFEP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|