C19H13FN4O2 — CID 67437158
7'-(6-fluoro-3-pyridinyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine (PubChem CID 67437158) has the molecular formula C19H13FN4O2 and a molecular weight of 348.34 g/mol. Its IUPAC name is 7'-(6-fluoro-3-pyridinyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine.
| Compound Name | 7'-(6-fluoro-3-pyridinyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine |
|---|---|
| PubChem CID | 67437158 |
| Molecular Formula | C19H13FN4O2 |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 7'-(6-fluoro-3-pyridinyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine |
| SMILES | NC1=NC2(CO1)c1ccncc1Oc1ccc(-c3ccc(F)nc3)cc12 |
| InChI | InChI=1S/C19H13FN4O2/c20-17-4-2-12(8-23-17)11-1-3-15-14(7-11)19(10-25-18(21)24-19)13-5-6-22-9-16(13)26-15/h1-9H,10H2,(H2,21,24) |
| InChIKey | XDZPILZCNQZUEA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|