C26H21F2N3O3 — CID 90003022
(4S)-4'-fluoro-7'-(6-fluoro-3-pyridinyl)-2'-(3-methoxy-3-methylbut-1-ynyl)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (PubChem CID 90003022) has the molecular formula C26H21F2N3O3 and a molecular weight of 461.47 g/mol. Its IUPAC name is (4S)-4'-fluoro-7'-(6-fluoro-3-pyridinyl)-2'-(3-methoxy-3-methylbut-1-ynyl)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
| Compound Name | (4S)-4'-fluoro-7'-(6-fluoro-3-pyridinyl)-2'-(3-methoxy-3-methylbut-1-ynyl)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 90003022 |
| Molecular Formula | C26H21F2N3O3 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | (4S)-4'-fluoro-7'-(6-fluoro-3-pyridinyl)-2'-(3-methoxy-3-methylbut-1-ynyl)spiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| SMILES | COC(C)(C)C#Cc1cc(F)c2c(c1)[C@]1(COC(N)=N1)c1cc(-c3ccc(F)nc3)ccc1O2 |
| InChI | InChI=1S/C26H21F2N3O3/c1-25(2,32-3)9-8-15-10-19-23(20(27)11-15)34-21-6-4-16(17-5-7-22(28)30-13-17)12-18(21)26(19)14-33-24(29)31-26/h4-7,10-13H,14H2,1-3H3,(H2,29,31)/t26-/m0/s1 |
| InChIKey | RHZSVAJJPKDIQZ-SANMLTNESA-N |
| XLogP | 4.50 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|