C17H14N2O4S — CID 151361828
methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid (PubChem CID 151361828) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid.
| Compound Name | methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid |
|---|---|
| PubChem CID | 151361828 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid |
| SMILES | CON(C(=O)O)C1=NC2(CS1)c1ccccc1Oc1ccccc12 |
| InChI | InChI=1S/C17H14N2O4S/c1-22-19(16(20)21)15-18-17(10-24-15)11-6-2-4-8-13(11)23-14-9-5-3-7-12(14)17/h2-9H,10H2,1H3,(H,20,21) |
| InChIKey | OOPZOEYMWNEASM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|