About methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid
methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid (PubChem CID 151361828) has the molecular formula C17H14N2O4S
and a molecular weight of 342.38 g/mol. Its IUPAC name is methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid.
Molecular Properties
| Compound Name | methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid |
| PubChem CID | 151361828 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid |
| SMILES | CON(C(=O)O)C1=NC2(CS1)c1ccccc1Oc1ccccc12 |
| InChI | InChI=1S/C17H14N2O4S/c1-22-19(16(20)21)15-18-17(10-24-15)11-6-2-4-8-13(11)23-14-9-5-3-7-12(14)17/h2-9H,10H2,1H3,(H,20,21) |
| InChIKey | OOPZOEYMWNEASM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid?
The IUPAC name of methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid (CID 151361828) is methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid.
What is the SMILES notation for methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid?
The canonical SMILES for methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid is CON(C(=O)O)C1=NC2(CS1)c1ccccc1Oc1ccccc12.
What is the InChIKey of methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid?
The InChIKey is OOPZOEYMWNEASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O4S/c1-22-19(16(20)21)15-18-17(10-24-15)11-6-2-4-8-13(11)23-14-9-5-3-7-12(14)17/h2-9H,10H2,1H3,(H,20,21).
What are the key properties of methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid?
methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid has a molecular weight of 342.38 g/mol, XLogP of 3.68, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy(spiro[5H-1,3-thiazole-4,9'-xanthene]-2-yl)carbamic acid is sourced from PubChem (CID 151361828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).