C24H21FN4O2S — CID 67383033
7'-(2-fluoro-3-pyridinyl)-3'-(oxan-4-yl)spiro[5H-1,3-thiazole-4,5'-chromeno[2,3-c]pyridine]-2-amine (PubChem CID 67383033) has the molecular formula C24H21FN4O2S and a molecular weight of 448.52 g/mol. Its IUPAC name is 7'-(2-fluoro-3-pyridinyl)-3'-(oxan-4-yl)spiro[5H-1,3-thiazole-4,5'-chromeno[2,3-c]pyridine]-2-amine.
| Compound Name | 7'-(2-fluoro-3-pyridinyl)-3'-(oxan-4-yl)spiro[5H-1,3-thiazole-4,5'-chromeno[2,3-c]pyridine]-2-amine |
|---|---|
| PubChem CID | 67383033 |
| Molecular Formula | C24H21FN4O2S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 7'-(2-fluoro-3-pyridinyl)-3'-(oxan-4-yl)spiro[5H-1,3-thiazole-4,5'-chromeno[2,3-c]pyridine]-2-amine |
| SMILES | NC1=NC2(CS1)c1cc(-c3cccnc3F)ccc1Oc1cnc(C3CCOCC3)cc12 |
| InChI | InChI=1S/C24H21FN4O2S/c25-22-16(2-1-7-27-22)15-3-4-20-17(10-15)24(13-32-23(26)29-24)18-11-19(28-12-21(18)31-20)14-5-8-30-9-6-14/h1-4,7,10-12,14H,5-6,8-9,13H2,(H2,26,29) |
| InChIKey | QQJUCTBBDYYWDP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|