C20H18ClFN2O3 — CID 67950257
(3aS,9R,9aS)-7-(3-chloro-5-fluorophenyl)-3a-methylspiro[3,9a-dihydro-2H-furo[3,2-b]chromene-9,4'-5H-1,3-oxazole]-2'-amine (PubChem CID 67950257) has the molecular formula C20H18ClFN2O3 and a molecular weight of 388.83 g/mol. Its IUPAC name is (3aS,9R,9aS)-7-(3-chloro-5-fluorophenyl)-3a-methylspiro[3,9a-dihydro-2H-furo[3,2-b]chromene-9,4'-5H-1,3-oxazole]-2'-amine.
| Compound Name | (3aS,9R,9aS)-7-(3-chloro-5-fluorophenyl)-3a-methylspiro[3,9a-dihydro-2H-furo[3,2-b]chromene-9,4'-5H-1,3-oxazole]-2'-amine |
|---|---|
| PubChem CID | 67950257 |
| Molecular Formula | C20H18ClFN2O3 |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (3aS,9R,9aS)-7-(3-chloro-5-fluorophenyl)-3a-methylspiro[3,9a-dihydro-2H-furo[3,2-b]chromene-9,4'-5H-1,3-oxazole]-2'-amine |
| SMILES | C[C@]12CCO[C@H]1[C@]1(COC(N)=N1)c1cc(-c3cc(F)cc(Cl)c3)ccc1O2 |
| InChI | InChI=1S/C20H18ClFN2O3/c1-19-4-5-25-17(19)20(10-26-18(23)24-20)15-8-11(2-3-16(15)27-19)12-6-13(21)9-14(22)7-12/h2-3,6-9,17H,4-5,10H2,1H3,(H2,23,24)/t17-,19+,20+/m1/s1 |
| InChIKey | VESZGIKXMUJUJN-HOJAQTOUSA-N |
| XLogP | 3.63 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |